C32H43NO5 — CID 72679364
3-(4-tert-butylphenyl)-7,7-dimethyl-4-(oxan-4-yl)spiro[3,6,8,9-tetrahydrofuro[3,4-c]quinoline-1,4'-oxane]-6,9-diol (PubChem CID 72679364) has the molecular formula C32H43NO5 and a molecular weight of 521.70 g/mol. Its IUPAC name is 3-(4-tert-butylphenyl)-7,7-dimethyl-4-(oxan-4-yl)spiro[3,6,8,9-tetrahydrofuro[3,4-c]quinoline-1,4'-oxane]-6,9-diol.
| Compound Name | 3-(4-tert-butylphenyl)-7,7-dimethyl-4-(oxan-4-yl)spiro[3,6,8,9-tetrahydrofuro[3,4-c]quinoline-1,4'-oxane]-6,9-diol |
|---|---|
| PubChem CID | 72679364 |
| Molecular Formula | C32H43NO5 |
| Molecular Weight | 521.70 g/mol |
| Exact Mass | 521.31 |
| IUPAC Name | 3-(4-tert-butylphenyl)-7,7-dimethyl-4-(oxan-4-yl)spiro[3,6,8,9-tetrahydrofuro[3,4-c]quinoline-1,4'-oxane]-6,9-diol |
| SMILES | CC(C)(C)c1ccc(C2OC3(CCOCC3)c3c4c(nc(C5CCOCC5)c32)C(O)C(C)(C)CC4O)cc1 |
| InChI | InChI=1S/C32H43NO5/c1-30(2,3)21-8-6-20(7-9-21)28-24-25(32(38-28)12-16-37-17-13-32)23-22(34)18-31(4,5)29(35)27(23)33-26(24)19-10-14-36-15-11-19/h6-9,19,22,28-29,34-35H,10-18H2,1-5H3 |
| InChIKey | LZAUFMCCLMRMJD-UHFFFAOYSA-N |
| XLogP | 5.90 |
| TPSA | 81.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.70 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |