C34H47F3N2O4Si — CID 162590709
tert-butyl-[(3R)-7,7-dimethyl-4-(oxan-4-yl)-3-[6-(trifluoromethyl)-3-pyridinyl]spiro[3,6,8,9-tetrahydrofuro[3,4-c]quinoline-1,4'-oxane]-9-yl]oxy-dimethylsilane (PubChem CID 162590709) has the molecular formula C34H47F3N2O4Si and a molecular weight of 632.84 g/mol. Its IUPAC name is tert-butyl-[(3R)-7,7-dimethyl-4-(oxan-4-yl)-3-[6-(trifluoromethyl)-3-pyridinyl]spiro[3,6,8,9-tetrahydrofuro[3,4-c]quinoline-1,4'-oxane]-9-yl]oxy-dimethylsilane.
| Compound Name | tert-butyl-[(3R)-7,7-dimethyl-4-(oxan-4-yl)-3-[6-(trifluoromethyl)-3-pyridinyl]spiro[3,6,8,9-tetrahydrofuro[3,4-c]quinoline-1,4'-oxane]-9-yl]oxy-dimethylsilane |
|---|---|
| PubChem CID | 162590709 |
| Molecular Formula | C34H47F3N2O4Si |
| Molecular Weight | 632.84 g/mol |
| Exact Mass | 632.33 |
| IUPAC Name | tert-butyl-[(3R)-7,7-dimethyl-4-(oxan-4-yl)-3-[6-(trifluoromethyl)-3-pyridinyl]spiro[3,6,8,9-tetrahydrofuro[3,4-c]quinoline-1,4'-oxane]-9-yl]oxy-dimethylsilane |
| SMILES | CC1(C)Cc2nc(C3CCOCC3)c3c(c2C(O[Si](C)(C)C(C)(C)C)C1)C1(CCOCC1)O[C@@H]3c1ccc(C(F)(F)F)nc1 |
| InChI | InChI=1S/C34H47F3N2O4Si/c1-31(2,3)44(6,7)43-24-19-32(4,5)18-23-26(24)28-27(29(39-23)21-10-14-40-15-11-21)30(42-33(28)12-16-41-17-13-33)22-8-9-25(38-20-22)34(35,36)37/h8-9,20-21,24,30H,10-19H2,1-7H3/t24?,30-/m1/s1 |
| InChIKey | TXBHTSWQSRRDRW-BXFARTRRSA-N |
| XLogP | 8.55 |
| TPSA | 62.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.84 |
| LogP ≤ 5 | 8.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|