C36H47F3N2O4Si — CID 77227784
5-[9-[tert-butyl(dimethyl)silyl]oxy-7,7-dimethyl-4-(oxan-4-yl)spiro[3,6,8,9-tetrahydrofuro[3,4-c]quinoline-1,4'-oxane]-3-yl]-2-(trifluoromethyl)benzonitrile (PubChem CID 77227784) has the molecular formula C36H47F3N2O4Si and a molecular weight of 656.86 g/mol. Its IUPAC name is 5-[9-[tert-butyl(dimethyl)silyl]oxy-7,7-dimethyl-4-(oxan-4-yl)spiro[3,6,8,9-tetrahydrofuro[3,4-c]quinoline-1,4'-oxane]-3-yl]-2-(trifluoromethyl)benzonitrile.
| Compound Name | 5-[9-[tert-butyl(dimethyl)silyl]oxy-7,7-dimethyl-4-(oxan-4-yl)spiro[3,6,8,9-tetrahydrofuro[3,4-c]quinoline-1,4'-oxane]-3-yl]-2-(trifluoromethyl)benzonitrile |
|---|---|
| PubChem CID | 77227784 |
| Molecular Formula | C36H47F3N2O4Si |
| Molecular Weight | 656.86 g/mol |
| Exact Mass | 656.33 |
| IUPAC Name | 5-[9-[tert-butyl(dimethyl)silyl]oxy-7,7-dimethyl-4-(oxan-4-yl)spiro[3,6,8,9-tetrahydrofuro[3,4-c]quinoline-1,4'-oxane]-3-yl]-2-(trifluoromethyl)benzonitrile |
| SMILES | CC1(C)Cc2nc(C3CCOCC3)c3c(c2C(O[Si](C)(C)C(C)(C)C)C1)C1(CCOCC1)OC3c1ccc(C(F)(F)F)c(C#N)c1 |
| InChI | InChI=1S/C36H47F3N2O4Si/c1-33(2,3)46(6,7)45-27-20-34(4,5)19-26-28(27)30-29(31(41-26)22-10-14-42-15-11-22)32(44-35(30)12-16-43-17-13-35)23-8-9-25(36(37,38)39)24(18-23)21-40/h8-9,18,22,27,32H,10-17,19-20H2,1-7H3 |
| InChIKey | OUGLAXZQAUNJRV-UHFFFAOYSA-N |
| XLogP | 9.03 |
| TPSA | 73.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 656.86 |
| LogP ≤ 5 | 9.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|