About CID 71258700
CID 71258700 (PubChem CID 71258700) has the molecular formula C28H29F3N2O3
and a molecular weight of 498.55 g/mol.
Molecular Properties
| Compound Name | CID 71258700 |
| PubChem CID | 71258700 |
| Molecular Formula | C28H29F3N2O3 |
| Molecular Weight | 498.55 g/mol |
| Exact Mass | 498.21 |
| IUPAC Name | — |
| SMILES | CC(C)c1nc2c(c3c1[C@@H](c1ccc(C(F)(F)F)c(C#N)c1)OC31CCOCC1)[C@@H](O)CC1(CC1)C2 |
| InChI | InChI=1S/C28H29F3N2O3/c1-15(2)24-22-23(21-19(33-24)12-26(5-6-26)13-20(21)34)27(7-9-35-10-8-27)36-25(22)16-3-4-18(28(29,30)31)17(11-16)14-32/h3-4,11,15,20,25,34H,5-10,12-13H2,1-2H3/t20-,25+/m0/s1 |
| InChIKey | ZIIHSRZZEXKPLG-NBGIEHNGSA-N |
| XLogP | 5.98 |
| TPSA | 75.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 36 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 498.55 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze CID 71258700 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 71258700?
The IUPAC name of CID 71258700 (CID 71258700) is not available.
What is the SMILES notation for CID 71258700?
The canonical SMILES for CID 71258700 is CC(C)c1nc2c(c3c1[C@@H](c1ccc(C(F)(F)F)c(C#N)c1)OC31CCOCC1)[C@@H](O)CC1(CC1)C2.
What is the InChIKey of CID 71258700?
The InChIKey is ZIIHSRZZEXKPLG-NBGIEHNGSA-N. The full InChI is InChI=1S/C28H29F3N2O3/c1-15(2)24-22-23(21-19(33-24)12-26(5-6-26)13-20(21)34)27(7-9-35-10-8-27)36-25(22)16-3-4-18(28(29,30)31)17(11-16)14-32/h3-4,11,15,20,25,34H,5-10,12-13H2,1-2H3/t20-,25+/m0/s1.
What are the key properties of CID 71258700?
CID 71258700 has a molecular weight of 498.55 g/mol, XLogP of 5.98, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for CID 71258700 is sourced from PubChem (CID 71258700), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).