C32H38FNO2Si — CID 135044742
tert-butyl-[[(1R,2R,9S,11S)-6-fluoro-14,14-dimethyl-5-naphthalen-2-yl-10-oxa-4-azapentacyclo[7.6.1.01,11.02,11.03,8]hexadeca-3,5,7-trien-13-yl]oxy]-dimethylsilane (PubChem CID 135044742) has the molecular formula C32H38FNO2Si and a molecular weight of 515.75 g/mol. Its IUPAC name is tert-butyl-[[(1R,2R,9S,11S)-6-fluoro-14,14-dimethyl-5-naphthalen-2-yl-10-oxa-4-azapentacyclo[7.6.1.01,11.02,11.03,8]hexadeca-3,5,7-trien-13-yl]oxy]-dimethylsilane.
| Compound Name | tert-butyl-[[(1R,2R,9S,11S)-6-fluoro-14,14-dimethyl-5-naphthalen-2-yl-10-oxa-4-azapentacyclo[7.6.1.01,11.02,11.03,8]hexadeca-3,5,7-trien-13-yl]oxy]-dimethylsilane |
|---|---|
| PubChem CID | 135044742 |
| Molecular Formula | C32H38FNO2Si |
| Molecular Weight | 515.75 g/mol |
| Exact Mass | 515.27 |
| IUPAC Name | tert-butyl-[[(1R,2R,9S,11S)-6-fluoro-14,14-dimethyl-5-naphthalen-2-yl-10-oxa-4-azapentacyclo[7.6.1.01,11.02,11.03,8]hexadeca-3,5,7-trien-13-yl]oxy]-dimethylsilane |
| SMILES | CC1(C)C[C@]23C[C@@H]4O[C@@]2(CC1O[Si](C)(C)C(C)(C)C)[C@H]3c1nc(-c2ccc3ccccc3c2)c(F)cc14 |
| InChI | InChI=1S/C32H38FNO2Si/c1-29(2,3)37(6,7)36-25-17-32-28-27-22(24(35-32)16-31(28,32)18-30(25,4)5)15-23(33)26(34-27)21-13-12-19-10-8-9-11-20(19)14-21/h8-15,24-25,28H,16-18H2,1-7H3/t24-,25?,28-,31-,32-/m0/s1 |
| InChIKey | OPROXCDYGCZUIV-OSYNEXSDSA-N |
| XLogP | 8.55 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.75 |
| LogP ≤ 5 | 8.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|