C26H30F3NO4 — CID 163466825
(3R,9S)-4-(1-methoxyethyl)-7,7-dimethyl-3-[4-(trifluoromethyl)phenyl]spiro[3,6,8,9-tetrahydrofuro[3,4-c]quinoline-1,3'-oxolane]-9-ol (PubChem CID 163466825) has the molecular formula C26H30F3NO4 and a molecular weight of 477.52 g/mol. Its IUPAC name is (3R,9S)-4-(1-methoxyethyl)-7,7-dimethyl-3-[4-(trifluoromethyl)phenyl]spiro[3,6,8,9-tetrahydrofuro[3,4-c]quinoline-1,3'-oxolane]-9-ol.
| Compound Name | (3R,9S)-4-(1-methoxyethyl)-7,7-dimethyl-3-[4-(trifluoromethyl)phenyl]spiro[3,6,8,9-tetrahydrofuro[3,4-c]quinoline-1,3'-oxolane]-9-ol |
|---|---|
| PubChem CID | 163466825 |
| Molecular Formula | C26H30F3NO4 |
| Molecular Weight | 477.52 g/mol |
| Exact Mass | 477.21 |
| IUPAC Name | (3R,9S)-4-(1-methoxyethyl)-7,7-dimethyl-3-[4-(trifluoromethyl)phenyl]spiro[3,6,8,9-tetrahydrofuro[3,4-c]quinoline-1,3'-oxolane]-9-ol |
| SMILES | COC(C)c1nc2c(c3c1[C@@H](c1ccc(C(F)(F)F)cc1)OC31CCOC1)[C@@H](O)CC(C)(C)C2 |
| InChI | InChI=1S/C26H30F3NO4/c1-14(32-4)22-20-21(19-17(30-22)11-24(2,3)12-18(19)31)25(9-10-33-13-25)34-23(20)15-5-7-16(8-6-15)26(27,28)29/h5-8,14,18,23,31H,9-13H2,1-4H3/t14?,18-,23+,25?/m0/s1 |
| InChIKey | BTIBJGKMKPODAQ-CFJKPKJISA-N |
| XLogP | 5.55 |
| TPSA | 60.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.52 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |