C26H30F3NO4S — CID 162589458
7,7-dimethyl-4-(methylsulfanyloxymethyl)-3-[4-(trifluoromethyl)phenyl]spiro[3,6,8,9-tetrahydrofuro[3,4-c]quinoline-1,4'-oxane]-9-ol (PubChem CID 162589458) has the molecular formula C26H30F3NO4S and a molecular weight of 509.59 g/mol. Its IUPAC name is 7,7-dimethyl-4-(methylsulfanyloxymethyl)-3-[4-(trifluoromethyl)phenyl]spiro[3,6,8,9-tetrahydrofuro[3,4-c]quinoline-1,4'-oxane]-9-ol.
| Compound Name | 7,7-dimethyl-4-(methylsulfanyloxymethyl)-3-[4-(trifluoromethyl)phenyl]spiro[3,6,8,9-tetrahydrofuro[3,4-c]quinoline-1,4'-oxane]-9-ol |
|---|---|
| PubChem CID | 162589458 |
| Molecular Formula | C26H30F3NO4S |
| Molecular Weight | 509.59 g/mol |
| Exact Mass | 509.18 |
| IUPAC Name | 7,7-dimethyl-4-(methylsulfanyloxymethyl)-3-[4-(trifluoromethyl)phenyl]spiro[3,6,8,9-tetrahydrofuro[3,4-c]quinoline-1,4'-oxane]-9-ol |
| SMILES | CSOCc1nc2c(c3c1C(c1ccc(C(F)(F)F)cc1)OC31CCOCC1)C(O)CC(C)(C)C2 |
| InChI | InChI=1S/C26H30F3NO4S/c1-24(2)12-17-20(19(31)13-24)22-21(18(30-17)14-33-35-3)23(34-25(22)8-10-32-11-9-25)15-4-6-16(7-5-15)26(27,28)29/h4-7,19,23,31H,8-14H2,1-3H3 |
| InChIKey | LFJFGUINPASDNV-UHFFFAOYSA-N |
| XLogP | 6.03 |
| TPSA | 60.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.59 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|