C31H39F3NO5S+ — CID 163836651
tert-butyl-[(3R,9S)-4-methoxycarbonyl-7,7-dimethyl-3-[4-(trifluoromethyl)phenyl]spiro[3,6,8,9-tetrahydrofuro[3,4-c]quinoline-1,4'-oxane]-9-yl]oxy-methylsulfanium (PubChem CID 163836651) has the molecular formula C31H39F3NO5S+ and a molecular weight of 594.72 g/mol. Its IUPAC name is tert-butyl-[(3R,9S)-4-methoxycarbonyl-7,7-dimethyl-3-[4-(trifluoromethyl)phenyl]spiro[3,6,8,9-tetrahydrofuro[3,4-c]quinoline-1,4'-oxane]-9-yl]oxy-methylsulfanium.
| Compound Name | tert-butyl-[(3R,9S)-4-methoxycarbonyl-7,7-dimethyl-3-[4-(trifluoromethyl)phenyl]spiro[3,6,8,9-tetrahydrofuro[3,4-c]quinoline-1,4'-oxane]-9-yl]oxy-methylsulfanium |
|---|---|
| PubChem CID | 163836651 |
| Molecular Formula | C31H39F3NO5S+ |
| Molecular Weight | 594.72 g/mol |
| Exact Mass | 594.25 |
| IUPAC Name | tert-butyl-[(3R,9S)-4-methoxycarbonyl-7,7-dimethyl-3-[4-(trifluoromethyl)phenyl]spiro[3,6,8,9-tetrahydrofuro[3,4-c]quinoline-1,4'-oxane]-9-yl]oxy-methylsulfanium |
| SMILES | COC(=O)c1nc2c(c3c1[C@@H](c1ccc(C(F)(F)F)cc1)OC31CCOCC1)[C@@H](O[S+](C)C(C)(C)C)CC(C)(C)C2 |
| InChI | InChI=1S/C31H39F3NO5S/c1-28(2,3)41(7)40-21-17-29(4,5)16-20-22(21)24-23(25(35-20)27(36)37-6)26(39-30(24)12-14-38-15-13-30)18-8-10-19(11-9-18)31(32,33)34/h8-11,21,26H,12-17H2,1-7H3/q+1/t21-,26+,41?/m0/s1 |
| InChIKey | OIICRHBZXVZVTR-JWEZALNYSA-N |
| XLogP | 7.00 |
| TPSA | 66.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.72 |
| LogP ≤ 5 | 7.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|