C27H28F3N3O3 — CID 163506210
5-[(1R,9S)-7,7-dimethyl-9-nitroso-4-propan-2-ylspiro[3,6,8,9-tetrahydrofuro[3,4-c]quinoline-1,3'-oxolane]-3-yl]-2-(trifluoromethyl)benzonitrile (PubChem CID 163506210) has the molecular formula C27H28F3N3O3 and a molecular weight of 499.53 g/mol. Its IUPAC name is 5-[(1R,9S)-7,7-dimethyl-9-nitroso-4-propan-2-ylspiro[3,6,8,9-tetrahydrofuro[3,4-c]quinoline-1,3'-oxolane]-3-yl]-2-(trifluoromethyl)benzonitrile.
| Compound Name | 5-[(1R,9S)-7,7-dimethyl-9-nitroso-4-propan-2-ylspiro[3,6,8,9-tetrahydrofuro[3,4-c]quinoline-1,3'-oxolane]-3-yl]-2-(trifluoromethyl)benzonitrile |
|---|---|
| PubChem CID | 163506210 |
| Molecular Formula | C27H28F3N3O3 |
| Molecular Weight | 499.53 g/mol |
| Exact Mass | 499.21 |
| IUPAC Name | 5-[(1R,9S)-7,7-dimethyl-9-nitroso-4-propan-2-ylspiro[3,6,8,9-tetrahydrofuro[3,4-c]quinoline-1,3'-oxolane]-3-yl]-2-(trifluoromethyl)benzonitrile |
| SMILES | CC(C)c1nc2c(c3c1C(c1ccc(C(F)(F)F)c(C#N)c1)O[C@]31CCOC1)[C@@H](N=O)CC(C)(C)C2 |
| InChI | InChI=1S/C27H28F3N3O3/c1-14(2)23-21-22(20-18(32-23)10-25(3,4)11-19(20)33-34)26(7-8-35-13-26)36-24(21)15-5-6-17(27(28,29)30)16(9-15)12-31/h5-6,9,14,19,24H,7-8,10-11,13H2,1-4H3/t19-,24?,26-/m0/s1 |
| InChIKey | CYUFHNFIVOQQCN-CQDIGAOQSA-N |
| XLogP | 6.61 |
| TPSA | 84.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.53 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |