C30H33F3N2O5 — CID 72679363
5-[6,9-dihydroxy-7,7-dimethyl-4-(oxan-4-yl)spiro[3,6,8,9-tetrahydrofuro[3,4-c]quinoline-1,4'-oxane]-3-yl]-2-(trifluoromethyl)benzonitrile (PubChem CID 72679363) has the molecular formula C30H33F3N2O5 and a molecular weight of 558.60 g/mol. Its IUPAC name is 5-[6,9-dihydroxy-7,7-dimethyl-4-(oxan-4-yl)spiro[3,6,8,9-tetrahydrofuro[3,4-c]quinoline-1,4'-oxane]-3-yl]-2-(trifluoromethyl)benzonitrile.
| Compound Name | 5-[6,9-dihydroxy-7,7-dimethyl-4-(oxan-4-yl)spiro[3,6,8,9-tetrahydrofuro[3,4-c]quinoline-1,4'-oxane]-3-yl]-2-(trifluoromethyl)benzonitrile |
|---|---|
| PubChem CID | 72679363 |
| Molecular Formula | C30H33F3N2O5 |
| Molecular Weight | 558.60 g/mol |
| Exact Mass | 558.23 |
| IUPAC Name | 5-[6,9-dihydroxy-7,7-dimethyl-4-(oxan-4-yl)spiro[3,6,8,9-tetrahydrofuro[3,4-c]quinoline-1,4'-oxane]-3-yl]-2-(trifluoromethyl)benzonitrile |
| SMILES | CC1(C)CC(O)c2c(nc(C3CCOCC3)c3c2C2(CCOCC2)OC3c2ccc(C(F)(F)F)c(C#N)c2)C1O |
| InChI | InChI=1S/C30H33F3N2O5/c1-28(2)14-20(36)21-23-22(24(35-25(21)27(28)37)16-5-9-38-10-6-16)26(40-29(23)7-11-39-12-8-29)17-3-4-19(30(31,32)33)18(13-17)15-34/h3-4,13,16,20,26-27,36-37H,5-12,14H2,1-2H3 |
| InChIKey | BRIHAUCTIHGNGF-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 104.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.60 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |