About CID 53467754
CID 53467754 (PubChem CID 53467754) has the molecular formula C29H33F3N2O5
and a molecular weight of 546.59 g/mol.
Molecular Properties
| Compound Name | CID 53467754 |
| PubChem CID | 53467754 |
| Molecular Formula | C29H33F3N2O5 |
| Molecular Weight | 546.59 g/mol |
| Exact Mass | 546.23 |
| IUPAC Name | — |
| SMILES | O[C@H]1CC2(CCC2)[C@@H](O)c2nc(C3CCOCC3)c3c(c21)C1(CCOCC1)O[C@@H]3c1ccc(C(F)(F)F)cn1 |
| InChI | InChI=1S/C29H33F3N2O5/c30-29(31,32)17-2-3-18(33-15-17)25-21-22(28(39-25)8-12-38-13-9-28)20-19(35)14-27(6-1-7-27)26(36)24(20)34-23(21)16-4-10-37-11-5-16/h2-3,15-16,19,25-26,35-36H,1,4-14H2/t19-,25+,26-/m0/s1 |
| InChIKey | TXDAWRZPENKEMZ-YZYNAAERSA-N |
| XLogP | 5.16 |
| TPSA | 93.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 39 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 546.59 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze CID 53467754 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 53467754?
The IUPAC name of CID 53467754 (CID 53467754) is not available.
What is the SMILES notation for CID 53467754?
The canonical SMILES for CID 53467754 is O[C@H]1CC2(CCC2)[C@@H](O)c2nc(C3CCOCC3)c3c(c21)C1(CCOCC1)O[C@@H]3c1ccc(C(F)(F)F)cn1.
What is the InChIKey of CID 53467754?
The InChIKey is TXDAWRZPENKEMZ-YZYNAAERSA-N. The full InChI is InChI=1S/C29H33F3N2O5/c30-29(31,32)17-2-3-18(33-15-17)25-21-22(28(39-25)8-12-38-13-9-28)20-19(35)14-27(6-1-7-27)26(36)24(20)34-23(21)16-4-10-37-11-5-16/h2-3,15-16,19,25-26,35-36H,1,4-14H2/t19-,25+,26-/m0/s1.
What are the key properties of CID 53467754?
CID 53467754 has a molecular weight of 546.59 g/mol, XLogP of 5.16, 2 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for CID 53467754 is sourced from PubChem (CID 53467754), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).