C29H33F3N2O5 — CID 53467754
CID 53467754 (PubChem CID 53467754) has the molecular formula C29H33F3N2O5 and a molecular weight of 546.59 g/mol.
| Compound Name | CID 53467754 |
|---|---|
| PubChem CID | 53467754 |
| Molecular Formula | C29H33F3N2O5 |
| Molecular Weight | 546.59 g/mol |
| Exact Mass | 546.23 |
| IUPAC Name | — |
| SMILES | O[C@H]1CC2(CCC2)[C@@H](O)c2nc(C3CCOCC3)c3c(c21)C1(CCOCC1)O[C@@H]3c1ccc(C(F)(F)F)cn1 |
| InChI | InChI=1S/C29H33F3N2O5/c30-29(31,32)17-2-3-18(33-15-17)25-21-22(28(39-25)8-12-38-13-9-28)20-19(35)14-27(6-1-7-27)26(36)24(20)34-23(21)16-4-10-37-11-5-16/h2-3,15-16,19,25-26,35-36H,1,4-14H2/t19-,25+,26-/m0/s1 |
| InChIKey | TXDAWRZPENKEMZ-YZYNAAERSA-N |
| XLogP | 5.16 |
| TPSA | 93.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.59 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |