C25H29F3INO2S — CID 162560786
2'-iodo-7,7-dimethyl-4-propan-2-yl-3-[5-(trifluoromethyl)thiophen-2-yl]spiro[3,6,8,9-tetrahydrofuro[3,4-c]quinoline-1,1'-cyclopentane]-9-ol (PubChem CID 162560786) has the molecular formula C25H29F3INO2S and a molecular weight of 591.48 g/mol. Its IUPAC name is 2'-iodo-7,7-dimethyl-4-propan-2-yl-3-[5-(trifluoromethyl)thiophen-2-yl]spiro[3,6,8,9-tetrahydrofuro[3,4-c]quinoline-1,1'-cyclopentane]-9-ol.
| Compound Name | 2'-iodo-7,7-dimethyl-4-propan-2-yl-3-[5-(trifluoromethyl)thiophen-2-yl]spiro[3,6,8,9-tetrahydrofuro[3,4-c]quinoline-1,1'-cyclopentane]-9-ol |
|---|---|
| PubChem CID | 162560786 |
| Molecular Formula | C25H29F3INO2S |
| Molecular Weight | 591.48 g/mol |
| Exact Mass | 591.09 |
| IUPAC Name | 2'-iodo-7,7-dimethyl-4-propan-2-yl-3-[5-(trifluoromethyl)thiophen-2-yl]spiro[3,6,8,9-tetrahydrofuro[3,4-c]quinoline-1,1'-cyclopentane]-9-ol |
| SMILES | CC(C)c1nc2c(c3c1C(c1ccc(C(F)(F)F)s1)OC31CCCC1I)C(O)CC(C)(C)C2 |
| InChI | InChI=1S/C25H29F3INO2S/c1-12(2)21-19-20(18-13(30-21)10-23(3,4)11-14(18)31)24(9-5-6-16(24)29)32-22(19)15-7-8-17(33-15)25(26,27)28/h7-8,12,14,16,22,31H,5-6,9-11H2,1-4H3 |
| InChIKey | YEHVTQHURLHVFV-UHFFFAOYSA-N |
| XLogP | 7.59 |
| TPSA | 42.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.48 |
| LogP ≤ 5 | 7.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|