C26H29F3N2O4 — CID 134445379
CID 134445379 (PubChem CID 134445379) has the molecular formula C26H29F3N2O4 and a molecular weight of 490.52 g/mol.
| Compound Name | CID 134445379 |
|---|---|
| PubChem CID | 134445379 |
| Molecular Formula | C26H29F3N2O4 |
| Molecular Weight | 490.52 g/mol |
| Exact Mass | 490.21 |
| IUPAC Name | — |
| SMILES | CC(C)c1nc2c(c3c1C(O)(c1ccc(C(F)(F)F)nc1)OC31CCOCC1)[C@@H](O)CC1(CC1)C2 |
| InChI | InChI=1S/C26H29F3N2O4/c1-14(2)22-21-20(19-16(31-22)11-23(5-6-23)12-17(19)32)24(7-9-34-10-8-24)35-25(21,33)15-3-4-18(30-13-15)26(27,28)29/h3-4,13-14,17,32-33H,5-12H2,1-2H3/t17-,25?/m0/s1 |
| InChIKey | YFKKDMHVWDPMSI-LFUZPPSTSA-N |
| XLogP | 4.61 |
| TPSA | 84.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.52 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |