About CID 134445379
CID 134445379 (PubChem CID 134445379) has the molecular formula C26H29F3N2O4
and a molecular weight of 490.52 g/mol.
Molecular Properties
| Compound Name | CID 134445379 |
| PubChem CID | 134445379 |
| Molecular Formula | C26H29F3N2O4 |
| Molecular Weight | 490.52 g/mol |
| Exact Mass | 490.21 |
| IUPAC Name | — |
| SMILES | CC(C)c1nc2c(c3c1C(O)(c1ccc(C(F)(F)F)nc1)OC31CCOCC1)[C@@H](O)CC1(CC1)C2 |
| InChI | InChI=1S/C26H29F3N2O4/c1-14(2)22-21-20(19-16(31-22)11-23(5-6-23)12-17(19)32)24(7-9-34-10-8-24)35-25(21,33)15-3-4-18(30-13-15)26(27,28)29/h3-4,13-14,17,32-33H,5-12H2,1-2H3/t17-,25?/m0/s1 |
| InChIKey | YFKKDMHVWDPMSI-LFUZPPSTSA-N |
| XLogP | 4.61 |
| TPSA | 84.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 490.52 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze CID 134445379 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 134445379?
The IUPAC name of CID 134445379 (CID 134445379) is not available.
What is the SMILES notation for CID 134445379?
The canonical SMILES for CID 134445379 is CC(C)c1nc2c(c3c1C(O)(c1ccc(C(F)(F)F)nc1)OC31CCOCC1)[C@@H](O)CC1(CC1)C2.
What is the InChIKey of CID 134445379?
The InChIKey is YFKKDMHVWDPMSI-LFUZPPSTSA-N. The full InChI is InChI=1S/C26H29F3N2O4/c1-14(2)22-21-20(19-16(31-22)11-23(5-6-23)12-17(19)32)24(7-9-34-10-8-24)35-25(21,33)15-3-4-18(30-13-15)26(27,28)29/h3-4,13-14,17,32-33H,5-12H2,1-2H3/t17-,25?/m0/s1.
What are the key properties of CID 134445379?
CID 134445379 has a molecular weight of 490.52 g/mol, XLogP of 4.61, 2 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for CID 134445379 is sourced from PubChem (CID 134445379), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).