C32H45F3N2O4Si — CID 123674927
CID 123674927 (PubChem CID 123674927) has the molecular formula C32H45F3N2O4Si and a molecular weight of 606.80 g/mol.
| Compound Name | CID 123674927 |
|---|---|
| PubChem CID | 123674927 |
| Molecular Formula | C32H45F3N2O4Si |
| Molecular Weight | 606.80 g/mol |
| Exact Mass | 606.31 |
| IUPAC Name | — |
| SMILES | CC(C)c1nc2c(c3c1C(O)(C1=CCC(C(F)(F)F)N=C1)OC31CCOCC1)C(O[Si](C)(C)C(C)(C)C)CC1(CC1)C2 |
| InChI | InChI=1S/C32H45F3N2O4Si/c1-19(2)27-26-25(24-21(37-27)16-29(10-11-29)17-22(24)40-42(6,7)28(3,4)5)30(12-14-39-15-13-30)41-31(26,38)20-8-9-23(36-18-20)32(33,34)35/h8,18-19,22-23,38H,9-17H2,1-7H3 |
| InChIKey | LGDDALBQSZKQIC-UHFFFAOYSA-N |
| XLogP | 7.51 |
| TPSA | 73.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.80 |
| LogP ≤ 5 | 7.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|