C31H39ClF3NO4Si — CID 87138949
CID 87138949 (PubChem CID 87138949) has the molecular formula C31H39ClF3NO4Si and a molecular weight of 610.19 g/mol.
| Compound Name | CID 87138949 |
|---|---|
| PubChem CID | 87138949 |
| Molecular Formula | C31H39ClF3NO4Si |
| Molecular Weight | 610.19 g/mol |
| Exact Mass | 609.23 |
| IUPAC Name | — |
| SMILES | CC(C)(C)[Si](C)(C)O[C@H]1CC2(CCC2)Cc2nc(Cl)c3c(c21)C1(CCOCC1)OC3(O)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C31H39ClF3NO4Si/c1-27(2,3)41(4,5)39-22-18-28(11-6-12-28)17-21-23(22)24-25(26(32)36-21)30(37,40-29(24)13-15-38-16-14-29)19-7-9-20(10-8-19)31(33,34)35/h7-10,22,37H,6,11-18H2,1-5H3/t22-,30?/m0/s1 |
| InChIKey | BKZHJSXONRBTTA-VUUJKMBOSA-N |
| XLogP | 8.16 |
| TPSA | 60.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.19 |
| LogP ≤ 5 | 8.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|