C23H38INO2Si — CID 67355135
[(5S)-5-[tert-butyl(dimethyl)silyl]oxy-4-iodo-2-propan-2-ylspiro[6,8-dihydro-5H-quinoline-7,1'-cyclopentane]-3-yl]methanol (PubChem CID 67355135) has the molecular formula C23H38INO2Si and a molecular weight of 515.55 g/mol. Its IUPAC name is [(5S)-5-[tert-butyl(dimethyl)silyl]oxy-4-iodo-2-propan-2-ylspiro[6,8-dihydro-5H-quinoline-7,1'-cyclopentane]-3-yl]methanol.
| Compound Name | [(5S)-5-[tert-butyl(dimethyl)silyl]oxy-4-iodo-2-propan-2-ylspiro[6,8-dihydro-5H-quinoline-7,1'-cyclopentane]-3-yl]methanol |
|---|---|
| PubChem CID | 67355135 |
| Molecular Formula | C23H38INO2Si |
| Molecular Weight | 515.55 g/mol |
| Exact Mass | 515.17 |
| IUPAC Name | [(5S)-5-[tert-butyl(dimethyl)silyl]oxy-4-iodo-2-propan-2-ylspiro[6,8-dihydro-5H-quinoline-7,1'-cyclopentane]-3-yl]methanol |
| SMILES | CC(C)c1nc2c(c(I)c1CO)[C@@H](O[Si](C)(C)C(C)(C)C)CC1(CCCC1)C2 |
| InChI | InChI=1S/C23H38INO2Si/c1-15(2)21-16(14-26)20(24)19-17(25-21)12-23(10-8-9-11-23)13-18(19)27-28(6,7)22(3,4)5/h15,18,26H,8-14H2,1-7H3/t18-/m0/s1 |
| InChIKey | YNCYJVCRUBKFSA-SFHVURJKSA-N |
| XLogP | 6.87 |
| TPSA | 42.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.55 |
| LogP ≤ 5 | 6.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|