C22H36INOSi — CID 151236452
tert-butyl-[(5S)-4-iodo-2-propan-2-ylspiro[6,8-dihydro-5H-quinoline-7,1'-cyclopentane]-5-yl]oxy-dimethylsilane (PubChem CID 151236452) has the molecular formula C22H36INOSi and a molecular weight of 485.53 g/mol. Its IUPAC name is tert-butyl-[(5S)-4-iodo-2-propan-2-ylspiro[6,8-dihydro-5H-quinoline-7,1'-cyclopentane]-5-yl]oxy-dimethylsilane.
| Compound Name | tert-butyl-[(5S)-4-iodo-2-propan-2-ylspiro[6,8-dihydro-5H-quinoline-7,1'-cyclopentane]-5-yl]oxy-dimethylsilane |
|---|---|
| PubChem CID | 151236452 |
| Molecular Formula | C22H36INOSi |
| Molecular Weight | 485.53 g/mol |
| Exact Mass | 485.16 |
| IUPAC Name | tert-butyl-[(5S)-4-iodo-2-propan-2-ylspiro[6,8-dihydro-5H-quinoline-7,1'-cyclopentane]-5-yl]oxy-dimethylsilane |
| SMILES | CC(C)c1cc(I)c2c(n1)CC1(CCCC1)C[C@@H]2O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C22H36INOSi/c1-15(2)17-12-16(23)20-18(24-17)13-22(10-8-9-11-22)14-19(20)25-26(6,7)21(3,4)5/h12,15,19H,8-11,13-14H2,1-7H3/t19-/m0/s1 |
| InChIKey | NPJMIRNFJFVCNJ-IBGZPJMESA-N |
| XLogP | 7.38 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.53 |
| LogP ≤ 5 | 7.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|