C28H42INO2Si — CID 66762968
[(5S)-5-[tert-butyl(dimethyl)silyl]oxy-4-iodo-7,7-dimethyl-2-propan-2-yl-6,8-dihydro-5H-quinolin-3-yl]-(4-methylphenyl)methanol (PubChem CID 66762968) has the molecular formula C28H42INO2Si and a molecular weight of 579.64 g/mol. Its IUPAC name is [(5S)-5-[tert-butyl(dimethyl)silyl]oxy-4-iodo-7,7-dimethyl-2-propan-2-yl-6,8-dihydro-5H-quinolin-3-yl]-(4-methylphenyl)methanol.
| Compound Name | [(5S)-5-[tert-butyl(dimethyl)silyl]oxy-4-iodo-7,7-dimethyl-2-propan-2-yl-6,8-dihydro-5H-quinolin-3-yl]-(4-methylphenyl)methanol |
|---|---|
| PubChem CID | 66762968 |
| Molecular Formula | C28H42INO2Si |
| Molecular Weight | 579.64 g/mol |
| Exact Mass | 579.20 |
| IUPAC Name | [(5S)-5-[tert-butyl(dimethyl)silyl]oxy-4-iodo-7,7-dimethyl-2-propan-2-yl-6,8-dihydro-5H-quinolin-3-yl]-(4-methylphenyl)methanol |
| SMILES | Cc1ccc(C(O)c2c(C(C)C)nc3c(c2I)[C@@H](O[Si](C)(C)C(C)(C)C)CC(C)(C)C3)cc1 |
| InChI | InChI=1S/C28H42INO2Si/c1-17(2)25-23(26(31)19-13-11-18(3)12-14-19)24(29)22-20(30-25)15-28(7,8)16-21(22)32-33(9,10)27(4,5)6/h11-14,17,21,26,31H,15-16H2,1-10H3/t21-,26?/m0/s1 |
| InChIKey | KJHBQSRVZVDBCM-GVNKFJBHSA-N |
| XLogP | 8.24 |
| TPSA | 42.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.64 |
| LogP ≤ 5 | 8.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|