C30H41F3INO3Si — CID 66761225
(R)-[5-[tert-butyl(dimethyl)silyl]oxy-4-iodo-7,7-dimethyl-2-(oxan-4-yl)-6,8-dihydro-5H-quinolin-3-yl]-[4-(trifluoromethyl)phenyl]methanol (PubChem CID 66761225) has the molecular formula C30H41F3INO3Si and a molecular weight of 675.65 g/mol. Its IUPAC name is (R)-[5-[tert-butyl(dimethyl)silyl]oxy-4-iodo-7,7-dimethyl-2-(oxan-4-yl)-6,8-dihydro-5H-quinolin-3-yl]-[4-(trifluoromethyl)phenyl]methanol.
| Compound Name | (R)-[5-[tert-butyl(dimethyl)silyl]oxy-4-iodo-7,7-dimethyl-2-(oxan-4-yl)-6,8-dihydro-5H-quinolin-3-yl]-[4-(trifluoromethyl)phenyl]methanol |
|---|---|
| PubChem CID | 66761225 |
| Molecular Formula | C30H41F3INO3Si |
| Molecular Weight | 675.65 g/mol |
| Exact Mass | 675.19 |
| IUPAC Name | (R)-[5-[tert-butyl(dimethyl)silyl]oxy-4-iodo-7,7-dimethyl-2-(oxan-4-yl)-6,8-dihydro-5H-quinolin-3-yl]-[4-(trifluoromethyl)phenyl]methanol |
| SMILES | CC1(C)Cc2nc(C3CCOCC3)c([C@H](O)c3ccc(C(F)(F)F)cc3)c(I)c2C(O[Si](C)(C)C(C)(C)C)C1 |
| InChI | InChI=1S/C30H41F3INO3Si/c1-28(2,3)39(6,7)38-22-17-29(4,5)16-21-23(22)25(34)24(26(35-21)18-12-14-37-15-13-18)27(36)19-8-10-20(11-9-19)30(31,32)33/h8-11,18,22,27,36H,12-17H2,1-7H3/t22?,27-/m1/s1 |
| InChIKey | LJSDKAZVGYDHCI-RZIURPKCSA-N |
| XLogP | 8.72 |
| TPSA | 51.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 675.65 |
| LogP ≤ 5 | 8.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|