C39H59NO7Si2 — CID 15816553
tert-butyl-[(2R,3R)-1-[3-[tert-butyl(dimethyl)silyl]oxy-4-methoxy-2,6-dimethylphenyl]-4-(4-methoxy-3-phenylmethoxyphenyl)-3-nitrobutan-2-yl]oxy-dimethylsilane (PubChem CID 15816553) has the molecular formula C39H59NO7Si2 and a molecular weight of 710.07 g/mol. Its IUPAC name is tert-butyl-[(2R,3R)-1-[3-[tert-butyl(dimethyl)silyl]oxy-4-methoxy-2,6-dimethylphenyl]-4-(4-methoxy-3-phenylmethoxyphenyl)-3-nitrobutan-2-yl]oxy-dimethylsilane.
| Compound Name | tert-butyl-[(2R,3R)-1-[3-[tert-butyl(dimethyl)silyl]oxy-4-methoxy-2,6-dimethylphenyl]-4-(4-methoxy-3-phenylmethoxyphenyl)-3-nitrobutan-2-yl]oxy-dimethylsilane |
|---|---|
| PubChem CID | 15816553 |
| Molecular Formula | C39H59NO7Si2 |
| Molecular Weight | 710.07 g/mol |
| Exact Mass | 709.38 |
| IUPAC Name | tert-butyl-[(2R,3R)-1-[3-[tert-butyl(dimethyl)silyl]oxy-4-methoxy-2,6-dimethylphenyl]-4-(4-methoxy-3-phenylmethoxyphenyl)-3-nitrobutan-2-yl]oxy-dimethylsilane |
| SMILES | COc1ccc(C[C@H]([C@@H](Cc2c(C)cc(OC)c(O[Si](C)(C)C(C)(C)C)c2C)O[Si](C)(C)C(C)(C)C)[N+](=O)[O-])cc1OCc1ccccc1 |
| InChI | InChI=1S/C39H59NO7Si2/c1-27-22-36(44-10)37(47-49(13,14)39(6,7)8)28(2)31(27)25-34(46-48(11,12)38(3,4)5)32(40(41)42)23-30-20-21-33(43-9)35(24-30)45-26-29-18-16-15-17-19-29/h15-22,24,32,34H,23,25-26H2,1-14H3/t32-,34-/m1/s1 |
| InChIKey | KNPGENDJXVSVFA-ZFEZZJPFSA-N |
| XLogP | 10.10 |
| TPSA | 89.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 710.07 |
| LogP ≤ 5 | 10.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|