C34H53IO6Si2 — CID 44557675
(1R)-1-[(3R,5S)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]cyclopenten-1-yl]-2-(6-iodo-2,3-dimethoxy-4-phenylmethoxyphenyl)ethanol (PubChem CID 44557675) has the molecular formula C34H53IO6Si2 and a molecular weight of 740.87 g/mol. Its IUPAC name is (1R)-1-[(3R,5S)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]cyclopenten-1-yl]-2-(6-iodo-2,3-dimethoxy-4-phenylmethoxyphenyl)ethanol.
| Compound Name | (1R)-1-[(3R,5S)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]cyclopenten-1-yl]-2-(6-iodo-2,3-dimethoxy-4-phenylmethoxyphenyl)ethanol |
|---|---|
| PubChem CID | 44557675 |
| Molecular Formula | C34H53IO6Si2 |
| Molecular Weight | 740.87 g/mol |
| Exact Mass | 740.24 |
| IUPAC Name | (1R)-1-[(3R,5S)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]cyclopenten-1-yl]-2-(6-iodo-2,3-dimethoxy-4-phenylmethoxyphenyl)ethanol |
| SMILES | COc1c(OCc2ccccc2)cc(I)c(C[C@@H](O)C2=C[C@H](O[Si](C)(C)C(C)(C)C)C[C@@H]2O[Si](C)(C)C(C)(C)C)c1OC |
| InChI | InChI=1S/C34H53IO6Si2/c1-33(2,3)42(9,10)40-24-18-26(29(19-24)41-43(11,12)34(4,5)6)28(36)20-25-27(35)21-30(32(38-8)31(25)37-7)39-22-23-16-14-13-15-17-23/h13-18,21,24,28-29,36H,19-20,22H2,1-12H3/t24-,28+,29-/m0/s1 |
| InChIKey | SUKMIDSUPHRQHL-DOUMQJFESA-N |
| XLogP | 8.90 |
| TPSA | 66.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 740.87 |
| LogP ≤ 5 | 8.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|