C18H21IO4 — CID 15240745
1-(2,2-dimethoxyethyl)-2-iodo-5-methoxy-4-phenylmethoxybenzene (PubChem CID 15240745) has the molecular formula C18H21IO4 and a molecular weight of 428.27 g/mol. Its IUPAC name is 1-(2,2-dimethoxyethyl)-2-iodo-5-methoxy-4-phenylmethoxybenzene.
| Compound Name | 1-(2,2-dimethoxyethyl)-2-iodo-5-methoxy-4-phenylmethoxybenzene |
|---|---|
| PubChem CID | 15240745 |
| Molecular Formula | C18H21IO4 |
| Molecular Weight | 428.27 g/mol |
| Exact Mass | 428.05 |
| IUPAC Name | 1-(2,2-dimethoxyethyl)-2-iodo-5-methoxy-4-phenylmethoxybenzene |
| SMILES | COc1cc(CC(OC)OC)c(I)cc1OCc1ccccc1 |
| InChI | InChI=1S/C18H21IO4/c1-20-16-9-14(10-18(21-2)22-3)15(19)11-17(16)23-12-13-7-5-4-6-8-13/h4-9,11,18H,10,12H2,1-3H3 |
| InChIKey | CDCHOLFVYLTGDS-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.27 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|