C13H19NO3Si — CID 13439664
2-(3,4-dimethoxyphenyl)-2-trimethylsilyloxyacetonitrile (PubChem CID 13439664) has the molecular formula C13H19NO3Si and a molecular weight of 265.38 g/mol. Its IUPAC name is 2-(3,4-dimethoxyphenyl)-2-trimethylsilyloxyacetonitrile.
| Compound Name | 2-(3,4-dimethoxyphenyl)-2-trimethylsilyloxyacetonitrile |
|---|---|
| PubChem CID | 13439664 |
| Molecular Formula | C13H19NO3Si |
| Molecular Weight | 265.38 g/mol |
| Exact Mass | 265.11 |
| IUPAC Name | 2-(3,4-dimethoxyphenyl)-2-trimethylsilyloxyacetonitrile |
| SMILES | COc1ccc(C(C#N)O[Si](C)(C)C)cc1OC |
| InChI | InChI=1S/C13H19NO3Si/c1-15-11-7-6-10(8-12(11)16-2)13(9-14)17-18(3,4)5/h6-8,13H,1-5H3 |
| InChIKey | JPHNQTJIYNBRBF-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 51.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.38 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|