C12H15NO4 — CID 103375794
2-(3,4-dimethoxyphenyl)-2-(2-hydroxyethoxy)acetonitrile (PubChem CID 103375794) has the molecular formula C12H15NO4 and a molecular weight of 237.25 g/mol. Its IUPAC name is 2-(3,4-dimethoxyphenyl)-2-(2-hydroxyethoxy)acetonitrile.
| Compound Name | 2-(3,4-dimethoxyphenyl)-2-(2-hydroxyethoxy)acetonitrile |
|---|---|
| PubChem CID | 103375794 |
| Molecular Formula | C12H15NO4 |
| Molecular Weight | 237.25 g/mol |
| Exact Mass | 237.10 |
| IUPAC Name | 2-(3,4-dimethoxyphenyl)-2-(2-hydroxyethoxy)acetonitrile |
| SMILES | COc1ccc(C(C#N)OCCO)cc1OC |
| InChI | InChI=1S/C12H15NO4/c1-15-10-4-3-9(7-11(10)16-2)12(8-13)17-6-5-14/h3-4,7,12,14H,5-6H2,1-2H3 |
| InChIKey | YTGUFSOIOWDFSD-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 71.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.25 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |