C14H20N2O2 — CID 116960515
2-[(3,4-dimethoxyphenyl)-(methylamino)methyl]butanenitrile (PubChem CID 116960515) has the molecular formula C14H20N2O2 and a molecular weight of 248.33 g/mol. Its IUPAC name is 2-[(3,4-dimethoxyphenyl)-(methylamino)methyl]butanenitrile.
| Compound Name | 2-[(3,4-dimethoxyphenyl)-(methylamino)methyl]butanenitrile |
|---|---|
| PubChem CID | 116960515 |
| Molecular Formula | C14H20N2O2 |
| Molecular Weight | 248.33 g/mol |
| Exact Mass | 248.15 |
| IUPAC Name | 2-[(3,4-dimethoxyphenyl)-(methylamino)methyl]butanenitrile |
| SMILES | CCC(C#N)C(NC)c1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C14H20N2O2/c1-5-10(9-15)14(16-2)11-6-7-12(17-3)13(8-11)18-4/h6-8,10,14,16H,5H2,1-4H3 |
| InChIKey | FPZFQRSJSPSTFY-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 54.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.33 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |