C34H58O7Si2 — CID 57337389
(2R,3S)-4,4-bis[4-[tert-butyl(dimethyl)silyl]oxy-3,5-dimethoxyphenyl]-2,3-dimethylbutan-1-ol (PubChem CID 57337389) has the molecular formula C34H58O7Si2 and a molecular weight of 635.00 g/mol. Its IUPAC name is (2R,3S)-4,4-bis[4-[tert-butyl(dimethyl)silyl]oxy-3,5-dimethoxyphenyl]-2,3-dimethylbutan-1-ol.
| Compound Name | (2R,3S)-4,4-bis[4-[tert-butyl(dimethyl)silyl]oxy-3,5-dimethoxyphenyl]-2,3-dimethylbutan-1-ol |
|---|---|
| PubChem CID | 57337389 |
| Molecular Formula | C34H58O7Si2 |
| Molecular Weight | 635.00 g/mol |
| Exact Mass | 634.37 |
| IUPAC Name | (2R,3S)-4,4-bis[4-[tert-butyl(dimethyl)silyl]oxy-3,5-dimethoxyphenyl]-2,3-dimethylbutan-1-ol |
| SMILES | COc1cc(C(c2cc(OC)c(O[Si](C)(C)C(C)(C)C)c(OC)c2)[C@H](C)[C@@H](C)CO)cc(OC)c1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C34H58O7Si2/c1-22(21-35)23(2)30(24-17-26(36-9)31(27(18-24)37-10)40-42(13,14)33(3,4)5)25-19-28(38-11)32(29(20-25)39-12)41-43(15,16)34(6,7)8/h17-20,22-23,30,35H,21H2,1-16H3/t22-,23+/m0/s1 |
| InChIKey | ORFKQAWTGPFWHL-XZOQPEGZSA-N |
| XLogP | 8.89 |
| TPSA | 75.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 635.00 |
| LogP ≤ 5 | 8.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|