C15H27O5PSi — CID 20634491
[4-[tert-butyl(dimethyl)silyl]oxy-3-methoxy-5-methylphenyl]methylphosphonic acid (PubChem CID 20634491) has the molecular formula C15H27O5PSi and a molecular weight of 346.44 g/mol. Its IUPAC name is [4-[tert-butyl(dimethyl)silyl]oxy-3-methoxy-5-methylphenyl]methylphosphonic acid.
| Compound Name | [4-[tert-butyl(dimethyl)silyl]oxy-3-methoxy-5-methylphenyl]methylphosphonic acid |
|---|---|
| PubChem CID | 20634491 |
| Molecular Formula | C15H27O5PSi |
| Molecular Weight | 346.44 g/mol |
| Exact Mass | 346.14 |
| IUPAC Name | [4-[tert-butyl(dimethyl)silyl]oxy-3-methoxy-5-methylphenyl]methylphosphonic acid |
| SMILES | COc1cc(CP(=O)(O)O)cc(C)c1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C15H27O5PSi/c1-11-8-12(10-21(16,17)18)9-13(19-5)14(11)20-22(6,7)15(2,3)4/h8-9H,10H2,1-7H3,(H2,16,17,18) |
| InChIKey | FMKWAFYSBVVTDG-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.44 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|