C17H31O5PSi — CID 91342581
tert-butyl-[4-(dimethoxyphosphorylmethyl)-2-methoxy-6-methylphenoxy]-dimethylsilane (PubChem CID 91342581) has the molecular formula C17H31O5PSi and a molecular weight of 374.49 g/mol. Its IUPAC name is tert-butyl-[4-(dimethoxyphosphorylmethyl)-2-methoxy-6-methylphenoxy]-dimethylsilane.
| Compound Name | tert-butyl-[4-(dimethoxyphosphorylmethyl)-2-methoxy-6-methylphenoxy]-dimethylsilane |
|---|---|
| PubChem CID | 91342581 |
| Molecular Formula | C17H31O5PSi |
| Molecular Weight | 374.49 g/mol |
| Exact Mass | 374.17 |
| IUPAC Name | tert-butyl-[4-(dimethoxyphosphorylmethyl)-2-methoxy-6-methylphenoxy]-dimethylsilane |
| SMILES | COc1cc(CP(=O)(OC)OC)cc(C)c1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C17H31O5PSi/c1-13-10-14(12-23(18,20-6)21-7)11-15(19-5)16(13)22-24(8,9)17(2,3)4/h10-11H,12H2,1-9H3 |
| InChIKey | SPISCDCXODSZTR-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.49 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|