C17H26Br2O3Si — CID 10552149
tert-butyl-[2-(2,2-dibromoethenyl)-5,6-dimethoxy-3-methylphenoxy]-dimethylsilane (PubChem CID 10552149) has the molecular formula C17H26Br2O3Si and a molecular weight of 466.29 g/mol. Its IUPAC name is tert-butyl-[2-(2,2-dibromoethenyl)-5,6-dimethoxy-3-methylphenoxy]-dimethylsilane.
| Compound Name | tert-butyl-[2-(2,2-dibromoethenyl)-5,6-dimethoxy-3-methylphenoxy]-dimethylsilane |
|---|---|
| PubChem CID | 10552149 |
| Molecular Formula | C17H26Br2O3Si |
| Molecular Weight | 466.29 g/mol |
| Exact Mass | 464.00 |
| IUPAC Name | tert-butyl-[2-(2,2-dibromoethenyl)-5,6-dimethoxy-3-methylphenoxy]-dimethylsilane |
| SMILES | COc1cc(C)c(C=C(Br)Br)c(O[Si](C)(C)C(C)(C)C)c1OC |
| InChI | InChI=1S/C17H26Br2O3Si/c1-11-9-13(20-5)16(21-6)15(12(11)10-14(18)19)22-23(7,8)17(2,3)4/h9-10H,1-8H3 |
| InChIKey | JLSYEROCZNMKRT-UHFFFAOYSA-N |
| XLogP | 6.48 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.29 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|