C17H27IO3Si — CID 10646466
tert-butyl-[2-[(E)-2-iodoethenyl]-5,6-dimethoxy-3-methylphenoxy]-dimethylsilane (PubChem CID 10646466) has the molecular formula C17H27IO3Si and a molecular weight of 434.39 g/mol. Its IUPAC name is tert-butyl-[2-[(E)-2-iodoethenyl]-5,6-dimethoxy-3-methylphenoxy]-dimethylsilane.
| Compound Name | tert-butyl-[2-[(E)-2-iodoethenyl]-5,6-dimethoxy-3-methylphenoxy]-dimethylsilane |
|---|---|
| PubChem CID | 10646466 |
| Molecular Formula | C17H27IO3Si |
| Molecular Weight | 434.39 g/mol |
| Exact Mass | 434.08 |
| IUPAC Name | tert-butyl-[2-[(E)-2-iodoethenyl]-5,6-dimethoxy-3-methylphenoxy]-dimethylsilane |
| SMILES | COc1cc(C)c(/C=C/I)c(O[Si](C)(C)C(C)(C)C)c1OC |
| InChI | InChI=1S/C17H27IO3Si/c1-12-11-14(19-5)16(20-6)15(13(12)9-10-18)21-22(7,8)17(2,3)4/h9-11H,1-8H3/b10-9+ |
| InChIKey | OEEPOKPVNHRMIU-MDZDMXLPSA-N |
| XLogP | 5.80 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.39 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|