C10H10F2N2 — CID 43115122
2-(3,4-difluorophenyl)-2-(ethylamino)acetonitrile (PubChem CID 43115122) has the molecular formula C10H10F2N2 and a molecular weight of 196.20 g/mol. Its IUPAC name is 2-(3,4-difluorophenyl)-2-(ethylamino)acetonitrile.
| Compound Name | 2-(3,4-difluorophenyl)-2-(ethylamino)acetonitrile |
|---|---|
| PubChem CID | 43115122 |
| Molecular Formula | C10H10F2N2 |
| Molecular Weight | 196.20 g/mol |
| Exact Mass | 196.08 |
| IUPAC Name | 2-(3,4-difluorophenyl)-2-(ethylamino)acetonitrile |
| SMILES | CCNC(C#N)c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C10H10F2N2/c1-2-14-10(6-13)7-3-4-8(11)9(12)5-7/h3-5,10,14H,2H2,1H3 |
| InChIKey | QEFHNYHBLCTCTO-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.20 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |