C14H9F3N2 — CID 54886674
2-(3,4-difluorophenyl)-2-(4-fluoroanilino)acetonitrile (PubChem CID 54886674) has the molecular formula C14H9F3N2 and a molecular weight of 262.23 g/mol. Its IUPAC name is 2-(3,4-difluorophenyl)-2-(4-fluoroanilino)acetonitrile.
| Compound Name | 2-(3,4-difluorophenyl)-2-(4-fluoroanilino)acetonitrile |
|---|---|
| PubChem CID | 54886674 |
| Molecular Formula | C14H9F3N2 |
| Molecular Weight | 262.23 g/mol |
| Exact Mass | 262.07 |
| IUPAC Name | 2-(3,4-difluorophenyl)-2-(4-fluoroanilino)acetonitrile |
| SMILES | N#CC(Nc1ccc(F)cc1)c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C14H9F3N2/c15-10-2-4-11(5-3-10)19-14(8-18)9-1-6-12(16)13(17)7-9/h1-7,14,19H |
| InChIKey | GOPZAHTYYXTCGR-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.23 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |