C14H9Cl3N2 — CID 54886328
2-(4-chloroanilino)-2-(3,5-dichlorophenyl)acetonitrile (PubChem CID 54886328) has the molecular formula C14H9Cl3N2 and a molecular weight of 311.60 g/mol. Its IUPAC name is 2-(4-chloroanilino)-2-(3,5-dichlorophenyl)acetonitrile.
| Compound Name | 2-(4-chloroanilino)-2-(3,5-dichlorophenyl)acetonitrile |
|---|---|
| PubChem CID | 54886328 |
| Molecular Formula | C14H9Cl3N2 |
| Molecular Weight | 311.60 g/mol |
| Exact Mass | 309.98 |
| IUPAC Name | 2-(4-chloroanilino)-2-(3,5-dichlorophenyl)acetonitrile |
| SMILES | N#CC(Nc1ccc(Cl)cc1)c1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C14H9Cl3N2/c15-10-1-3-13(4-2-10)19-14(8-18)9-5-11(16)7-12(17)6-9/h1-7,14,19H |
| InChIKey | ZGLZOHAFYAUBAV-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.60 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |