C14H10Cl2N2 — CID 6925339
(2S)-2-(3,5-dichloroanilino)-2-phenylacetonitrile (PubChem CID 6925339) has the molecular formula C14H10Cl2N2 and a molecular weight of 277.15 g/mol. Its IUPAC name is (2S)-2-(3,5-dichloroanilino)-2-phenylacetonitrile.
| Compound Name | (2S)-2-(3,5-dichloroanilino)-2-phenylacetonitrile |
|---|---|
| PubChem CID | 6925339 |
| Molecular Formula | C14H10Cl2N2 |
| Molecular Weight | 277.15 g/mol |
| Exact Mass | 276.02 |
| IUPAC Name | (2S)-2-(3,5-dichloroanilino)-2-phenylacetonitrile |
| SMILES | N#C[C@@H](Nc1cc(Cl)cc(Cl)c1)c1ccccc1 |
| InChI | InChI=1S/C14H10Cl2N2/c15-11-6-12(16)8-13(7-11)18-14(9-17)10-4-2-1-3-5-10/h1-8,14,18H/t14-/m1/s1 |
| InChIKey | BEMWWQWEHGUKEN-CQSZACIVSA-N |
| XLogP | 4.67 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.15 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |