C14H10F2N2 — CID 54886668
2-anilino-2-(3,4-difluorophenyl)acetonitrile (PubChem CID 54886668) has the molecular formula C14H10F2N2 and a molecular weight of 244.24 g/mol. Its IUPAC name is 2-anilino-2-(3,4-difluorophenyl)acetonitrile.
| Compound Name | 2-anilino-2-(3,4-difluorophenyl)acetonitrile |
|---|---|
| PubChem CID | 54886668 |
| Molecular Formula | C14H10F2N2 |
| Molecular Weight | 244.24 g/mol |
| Exact Mass | 244.08 |
| IUPAC Name | 2-anilino-2-(3,4-difluorophenyl)acetonitrile |
| SMILES | N#CC(Nc1ccccc1)c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C14H10F2N2/c15-12-7-6-10(8-13(12)16)14(9-17)18-11-4-2-1-3-5-11/h1-8,14,18H |
| InChIKey | ITARXHSSOMPGKK-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.24 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |