About 2-[3-(2,4,6-trimethylphenyl)-2H-imidazol-1-yl]ethyl morpholine-4-carboxylate
2-[3-(2,4,6-trimethylphenyl)-2H-imidazol-1-yl]ethyl morpholine-4-carboxylate (PubChem CID 166009273) has the molecular formula C19H27N3O3
and a molecular weight of 345.44 g/mol. Its IUPAC name is 2-[3-(2,4,6-trimethylphenyl)-2H-imidazol-1-yl]ethyl morpholine-4-carboxylate.
Molecular Properties
| Compound Name | 2-[3-(2,4,6-trimethylphenyl)-2H-imidazol-1-yl]ethyl morpholine-4-carboxylate |
| PubChem CID | 166009273 |
| Molecular Formula | C19H27N3O3 |
| Molecular Weight | 345.44 g/mol |
| Exact Mass | 345.21 |
| IUPAC Name | 2-[3-(2,4,6-trimethylphenyl)-2H-imidazol-1-yl]ethyl morpholine-4-carboxylate |
| SMILES | Cc1cc(C)c(N2C=CN(CCOC(=O)N3CCOCC3)C2)c(C)c1 |
| InChI | InChI=1S/C19H27N3O3/c1-15-12-16(2)18(17(3)13-15)22-5-4-20(14-22)6-11-25-19(23)21-7-9-24-10-8-21/h4-5,12-13H,6-11,14H2,1-3H3 |
| InChIKey | GBKUYZAHUDUAFL-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 45.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 345.44 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-[3-(2,4,6-trimethylphenyl)-2H-imidazol-1-yl]ethyl morpholine-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[3-(2,4,6-trimethylphenyl)-2H-imidazol-1-yl]ethyl morpholine-4-carboxylate?
The IUPAC name of 2-[3-(2,4,6-trimethylphenyl)-2H-imidazol-1-yl]ethyl morpholine-4-carboxylate (CID 166009273) is 2-[3-(2,4,6-trimethylphenyl)-2H-imidazol-1-yl]ethyl morpholine-4-carboxylate.
What is the SMILES notation for 2-[3-(2,4,6-trimethylphenyl)-2H-imidazol-1-yl]ethyl morpholine-4-carboxylate?
The canonical SMILES for 2-[3-(2,4,6-trimethylphenyl)-2H-imidazol-1-yl]ethyl morpholine-4-carboxylate is Cc1cc(C)c(N2C=CN(CCOC(=O)N3CCOCC3)C2)c(C)c1.
What is the InChIKey of 2-[3-(2,4,6-trimethylphenyl)-2H-imidazol-1-yl]ethyl morpholine-4-carboxylate?
The InChIKey is GBKUYZAHUDUAFL-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H27N3O3/c1-15-12-16(2)18(17(3)13-15)22-5-4-20(14-22)6-11-25-19(23)21-7-9-24-10-8-21/h4-5,12-13H,6-11,14H2,1-3H3.
What are the key properties of 2-[3-(2,4,6-trimethylphenyl)-2H-imidazol-1-yl]ethyl morpholine-4-carboxylate?
2-[3-(2,4,6-trimethylphenyl)-2H-imidazol-1-yl]ethyl morpholine-4-carboxylate has a molecular weight of 345.44 g/mol, XLogP of 2.63, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[3-(2,4,6-trimethylphenyl)-2H-imidazol-1-yl]ethyl morpholine-4-carboxylate is sourced from PubChem (CID 166009273), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).