C21H27Cl2N3O — CID 175231814
1,3-bis(2,4,6-trimethylphenyl)imidazolidin-4-imine;chloro hypochlorite (PubChem CID 175231814) has the molecular formula C21H27Cl2N3O and a molecular weight of 408.37 g/mol. Its IUPAC name is 1,3-bis(2,4,6-trimethylphenyl)imidazolidin-4-imine;chloro hypochlorite.
| Compound Name | 1,3-bis(2,4,6-trimethylphenyl)imidazolidin-4-imine;chloro hypochlorite |
|---|---|
| PubChem CID | 175231814 |
| Molecular Formula | C21H27Cl2N3O |
| Molecular Weight | 408.37 g/mol |
| Exact Mass | 407.15 |
| IUPAC Name | 1,3-bis(2,4,6-trimethylphenyl)imidazolidin-4-imine;chloro hypochlorite |
| SMILES | ClOCl.[H]/N=C1\CN(c2c(C)cc(C)cc2C)CN1c1c(C)cc(C)cc1C |
| InChI | InChI=1S/C21H27N3.Cl2O/c1-13-7-15(3)20(16(4)8-13)23-11-19(22)24(12-23)21-17(5)9-14(2)10-18(21)6;1-3-2/h7-10,22H,11-12H2,1-6H3;/b22-19+; |
| InChIKey | TWKJXRJOVACDHC-KWNKHXGFSA-N |
| XLogP | 6.11 |
| TPSA | 39.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.37 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|