C23H29ClN2 — CID 171378130
4-(chloromethyl)-5-methyl-1,3-bis(2,4,6-trimethylphenyl)-2H-imidazole (PubChem CID 171378130) has the molecular formula C23H29ClN2 and a molecular weight of 368.95 g/mol. Its IUPAC name is 4-(chloromethyl)-5-methyl-1,3-bis(2,4,6-trimethylphenyl)-2H-imidazole.
| Compound Name | 4-(chloromethyl)-5-methyl-1,3-bis(2,4,6-trimethylphenyl)-2H-imidazole |
|---|---|
| PubChem CID | 171378130 |
| Molecular Formula | C23H29ClN2 |
| Molecular Weight | 368.95 g/mol |
| Exact Mass | 368.20 |
| IUPAC Name | 4-(chloromethyl)-5-methyl-1,3-bis(2,4,6-trimethylphenyl)-2H-imidazole |
| SMILES | CC1=C(CCl)N(c2c(C)cc(C)cc2C)CN1c1c(C)cc(C)cc1C |
| InChI | InChI=1S/C23H29ClN2/c1-14-8-16(3)22(17(4)9-14)25-13-26(21(12-24)20(25)7)23-18(5)10-15(2)11-19(23)6/h8-11H,12-13H2,1-7H3 |
| InChIKey | GQEHAIGKQDTYKJ-UHFFFAOYSA-N |
| XLogP | 6.29 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.95 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|