C39H43F3N4 — CID 164730615
1-[3-[4,5-dimethyl-3-(2,4,6-trimethylphenyl)-2H-imidazol-1-yl]-5-(trifluoromethyl)phenyl]-5,6-dimethyl-3-(2,4,6-trimethylphenyl)-2H-benzimidazole (PubChem CID 164730615) has the molecular formula C39H43F3N4 and a molecular weight of 624.80 g/mol. Its IUPAC name is 1-[3-[4,5-dimethyl-3-(2,4,6-trimethylphenyl)-2H-imidazol-1-yl]-5-(trifluoromethyl)phenyl]-5,6-dimethyl-3-(2,4,6-trimethylphenyl)-2H-benzimidazole.
| Compound Name | 1-[3-[4,5-dimethyl-3-(2,4,6-trimethylphenyl)-2H-imidazol-1-yl]-5-(trifluoromethyl)phenyl]-5,6-dimethyl-3-(2,4,6-trimethylphenyl)-2H-benzimidazole |
|---|---|
| PubChem CID | 164730615 |
| Molecular Formula | C39H43F3N4 |
| Molecular Weight | 624.80 g/mol |
| Exact Mass | 624.34 |
| IUPAC Name | 1-[3-[4,5-dimethyl-3-(2,4,6-trimethylphenyl)-2H-imidazol-1-yl]-5-(trifluoromethyl)phenyl]-5,6-dimethyl-3-(2,4,6-trimethylphenyl)-2H-benzimidazole |
| SMILES | CC1=C(C)N(c2c(C)cc(C)cc2C)CN1c1cc(N2CN(c3c(C)cc(C)cc3C)c3cc(C)c(C)cc32)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C39H43F3N4/c1-22-11-26(5)37(27(6)12-22)44-20-43(30(9)31(44)10)33-17-32(39(40,41)42)18-34(19-33)45-21-46(36-16-25(4)24(3)15-35(36)45)38-28(7)13-23(2)14-29(38)8/h11-19H,20-21H2,1-10H3 |
| InChIKey | CXEKJVAGHWQADY-UHFFFAOYSA-N |
| XLogP | 10.96 |
| TPSA | 12.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.80 |
| LogP ≤ 5 | 10.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |