C9H7F3N4O — CID 137043624
4-[3-methyl-5-(trifluoromethyl)phenyl]-1H-tetrazol-5-one (PubChem CID 137043624) has the molecular formula C9H7F3N4O and a molecular weight of 244.18 g/mol. Its IUPAC name is 4-[3-methyl-5-(trifluoromethyl)phenyl]-1H-tetrazol-5-one.
| Compound Name | 4-[3-methyl-5-(trifluoromethyl)phenyl]-1H-tetrazol-5-one |
|---|---|
| PubChem CID | 137043624 |
| Molecular Formula | C9H7F3N4O |
| Molecular Weight | 244.18 g/mol |
| Exact Mass | 244.06 |
| IUPAC Name | 4-[3-methyl-5-(trifluoromethyl)phenyl]-1H-tetrazol-5-one |
| SMILES | Cc1cc(-n2nn[nH]c2=O)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C9H7F3N4O/c1-5-2-6(9(10,11)12)4-7(3-5)16-8(17)13-14-15-16/h2-4H,1H3,(H,13,15,17) |
| InChIKey | FNFLNHWXTUGZOT-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 63.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.18 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |