C11H11F3N4 — CID 143612480
1-[3-ethyl-5-(trifluoromethyl)phenyl]-5-methyltetrazole (PubChem CID 143612480) has the molecular formula C11H11F3N4 and a molecular weight of 256.23 g/mol. Its IUPAC name is 1-[3-ethyl-5-(trifluoromethyl)phenyl]-5-methyltetrazole.
| Compound Name | 1-[3-ethyl-5-(trifluoromethyl)phenyl]-5-methyltetrazole |
|---|---|
| PubChem CID | 143612480 |
| Molecular Formula | C11H11F3N4 |
| Molecular Weight | 256.23 g/mol |
| Exact Mass | 256.09 |
| IUPAC Name | 1-[3-ethyl-5-(trifluoromethyl)phenyl]-5-methyltetrazole |
| SMILES | CCc1cc(-n2nnnc2C)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C11H11F3N4/c1-3-8-4-9(11(12,13)14)6-10(5-8)18-7(2)15-16-17-18/h4-6H,3H2,1-2H3 |
| InChIKey | HVMNFQCXFVXCPM-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.23 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |