C8H5F3N4O2 — CID 136967601
4-[3-(trifluoromethoxy)-2-tritiophenyl]-1H-tetrazol-5-one (PubChem CID 136967601) has the molecular formula C8H5F3N4O2 and a molecular weight of 248.16 g/mol. Its IUPAC name is 4-[3-(trifluoromethoxy)-2-tritiophenyl]-1H-tetrazol-5-one.
| Compound Name | 4-[3-(trifluoromethoxy)-2-tritiophenyl]-1H-tetrazol-5-one |
|---|---|
| PubChem CID | 136967601 |
| Molecular Formula | C8H5F3N4O2 |
| Molecular Weight | 248.16 g/mol |
| Exact Mass | 248.04 |
| IUPAC Name | 4-[3-(trifluoromethoxy)-2-tritiophenyl]-1H-tetrazol-5-one |
| SMILES | [3H]c1c(OC(F)(F)F)cccc1-n1nn[nH]c1=O |
| InChI | InChI=1S/C8H5F3N4O2/c9-8(10,11)17-6-3-1-2-5(4-6)15-7(16)12-13-14-15/h1-4H,(H,12,14,16)/i4T |
| InChIKey | XZJPOAMKGOAFCK-IBTRZKOZSA-N |
| XLogP | 0.85 |
| TPSA | 72.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.16 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |