C8H7F3N4O2 — CID 87967895
2-[3-(trifluoromethoxy)phenyl]tetrazolidin-5-one (PubChem CID 87967895) has the molecular formula C8H7F3N4O2 and a molecular weight of 248.16 g/mol. Its IUPAC name is 2-[3-(trifluoromethoxy)phenyl]tetrazolidin-5-one.
| Compound Name | 2-[3-(trifluoromethoxy)phenyl]tetrazolidin-5-one |
|---|---|
| PubChem CID | 87967895 |
| Molecular Formula | C8H7F3N4O2 |
| Molecular Weight | 248.16 g/mol |
| Exact Mass | 248.05 |
| IUPAC Name | 2-[3-(trifluoromethoxy)phenyl]tetrazolidin-5-one |
| SMILES | O=C1NNN(c2cccc(OC(F)(F)F)c2)N1 |
| InChI | InChI=1S/C8H7F3N4O2/c9-8(10,11)17-6-3-1-2-5(4-6)15-13-7(16)12-14-15/h1-4,14H,(H2,12,13,16) |
| InChIKey | FPRAYDHNSJGOAO-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 65.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.16 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |