C18H16F3NO3 — CID 68546042
4-[3-(trifluoromethoxy)phenyl]-4-azatetracyclo[5.3.2.02,6.08,10]dodecane-3,5-dione (PubChem CID 68546042) has the molecular formula C18H16F3NO3 and a molecular weight of 351.32 g/mol. Its IUPAC name is 4-[3-(trifluoromethoxy)phenyl]-4-azatetracyclo[5.3.2.02,6.08,10]dodecane-3,5-dione.
| Compound Name | 4-[3-(trifluoromethoxy)phenyl]-4-azatetracyclo[5.3.2.02,6.08,10]dodecane-3,5-dione |
|---|---|
| PubChem CID | 68546042 |
| Molecular Formula | C18H16F3NO3 |
| Molecular Weight | 351.32 g/mol |
| Exact Mass | 351.11 |
| IUPAC Name | 4-[3-(trifluoromethoxy)phenyl]-4-azatetracyclo[5.3.2.02,6.08,10]dodecane-3,5-dione |
| SMILES | O=C1C2C3CCC(C4CC43)C2C(=O)N1c1cccc(OC(F)(F)F)c1 |
| InChI | InChI=1S/C18H16F3NO3/c19-18(20,21)25-9-3-1-2-8(6-9)22-16(23)14-10-4-5-11(13-7-12(10)13)15(14)17(22)24/h1-3,6,10-15H,4-5,7H2 |
| InChIKey | XAVLWQIFMWCBNI-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.32 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|