C19H18F3NO3 — CID 68547027
(1S,2S,6R,7R,8R,10S)-4-[4-methoxy-3-(trifluoromethyl)phenyl]-4-azatetracyclo[5.3.2.02,6.08,10]dodecane-3,5-dione (PubChem CID 68547027) has the molecular formula C19H18F3NO3 and a molecular weight of 365.35 g/mol. Its IUPAC name is (1S,2S,6R,7R,8R,10S)-4-[4-methoxy-3-(trifluoromethyl)phenyl]-4-azatetracyclo[5.3.2.02,6.08,10]dodecane-3,5-dione.
| Compound Name | (1S,2S,6R,7R,8R,10S)-4-[4-methoxy-3-(trifluoromethyl)phenyl]-4-azatetracyclo[5.3.2.02,6.08,10]dodecane-3,5-dione |
|---|---|
| PubChem CID | 68547027 |
| Molecular Formula | C19H18F3NO3 |
| Molecular Weight | 365.35 g/mol |
| Exact Mass | 365.12 |
| IUPAC Name | (1S,2S,6R,7R,8R,10S)-4-[4-methoxy-3-(trifluoromethyl)phenyl]-4-azatetracyclo[5.3.2.02,6.08,10]dodecane-3,5-dione |
| SMILES | COc1ccc(N2C(=O)[C@@H]3[C@@H]4CC[C@@H]([C@H]5C[C@H]54)[C@@H]3C2=O)cc1C(F)(F)F |
| InChI | InChI=1S/C19H18F3NO3/c1-26-14-5-2-8(6-13(14)19(20,21)22)23-17(24)15-9-3-4-10(12-7-11(9)12)16(15)18(23)25/h2,5-6,9-12,15-16H,3-4,7H2,1H3/t9-,10+,11+,12-,15-,16+ |
| InChIKey | LOVJEUPTYPSUAJ-OCNXXKCSSA-N |
| XLogP | 3.50 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.35 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|