C18H18FNO2 — CID 68546443
4-(4-fluoro-3-methylphenyl)-4-azatetracyclo[5.3.2.02,6.08,10]dodecane-3,5-dione (PubChem CID 68546443) has the molecular formula C18H18FNO2 and a molecular weight of 299.35 g/mol. Its IUPAC name is 4-(4-fluoro-3-methylphenyl)-4-azatetracyclo[5.3.2.02,6.08,10]dodecane-3,5-dione.
| Compound Name | 4-(4-fluoro-3-methylphenyl)-4-azatetracyclo[5.3.2.02,6.08,10]dodecane-3,5-dione |
|---|---|
| PubChem CID | 68546443 |
| Molecular Formula | C18H18FNO2 |
| Molecular Weight | 299.35 g/mol |
| Exact Mass | 299.13 |
| IUPAC Name | 4-(4-fluoro-3-methylphenyl)-4-azatetracyclo[5.3.2.02,6.08,10]dodecane-3,5-dione |
| SMILES | Cc1cc(N2C(=O)C3C4CCC(C5CC54)C3C2=O)ccc1F |
| InChI | InChI=1S/C18H18FNO2/c1-8-6-9(2-5-14(8)19)20-17(21)15-10-3-4-11(13-7-12(10)13)16(15)18(20)22/h2,5-6,10-13,15-16H,3-4,7H2,1H3 |
| InChIKey | HGAAGFPJOPUXDG-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.35 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|