C12H11F4NO4S — CID 168677693
[5-oxo-1-[3-(trifluoromethoxy)phenyl]pyrrolidin-3-yl]methanesulfonyl fluoride (PubChem CID 168677693) has the molecular formula C12H11F4NO4S and a molecular weight of 341.28 g/mol. Its IUPAC name is [5-oxo-1-[3-(trifluoromethoxy)phenyl]pyrrolidin-3-yl]methanesulfonyl fluoride.
| Compound Name | [5-oxo-1-[3-(trifluoromethoxy)phenyl]pyrrolidin-3-yl]methanesulfonyl fluoride |
|---|---|
| PubChem CID | 168677693 |
| Molecular Formula | C12H11F4NO4S |
| Molecular Weight | 341.28 g/mol |
| Exact Mass | 341.03 |
| IUPAC Name | [5-oxo-1-[3-(trifluoromethoxy)phenyl]pyrrolidin-3-yl]methanesulfonyl fluoride |
| SMILES | O=C1CC(CS(=O)(=O)F)CN1c1cccc(OC(F)(F)F)c1 |
| InChI | InChI=1S/C12H11F4NO4S/c13-12(14,15)21-10-3-1-2-9(5-10)17-6-8(4-11(17)18)7-22(16,19)20/h1-3,5,8H,4,6-7H2 |
| InChIKey | ZNBCEKQTMDVSPE-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.28 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |