C14H13FN2O3S — CID 168677612
(1-isoquinolin-6-yl-5-oxopyrrolidin-3-yl)methanesulfonyl fluoride (PubChem CID 168677612) has the molecular formula C14H13FN2O3S and a molecular weight of 308.33 g/mol. Its IUPAC name is (1-isoquinolin-6-yl-5-oxopyrrolidin-3-yl)methanesulfonyl fluoride.
| Compound Name | (1-isoquinolin-6-yl-5-oxopyrrolidin-3-yl)methanesulfonyl fluoride |
|---|---|
| PubChem CID | 168677612 |
| Molecular Formula | C14H13FN2O3S |
| Molecular Weight | 308.33 g/mol |
| Exact Mass | 308.06 |
| IUPAC Name | (1-isoquinolin-6-yl-5-oxopyrrolidin-3-yl)methanesulfonyl fluoride |
| SMILES | O=C1CC(CS(=O)(=O)F)CN1c1ccc2cnccc2c1 |
| InChI | InChI=1S/C14H13FN2O3S/c15-21(19,20)9-10-5-14(18)17(8-10)13-2-1-12-7-16-4-3-11(12)6-13/h1-4,6-7,10H,5,8-9H2 |
| InChIKey | OWORSWWCSYVHDB-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 67.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.33 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |