C9H10FN3O3S — CID 168677760
(5-oxo-1-pyridazin-4-ylpyrrolidin-3-yl)methanesulfonyl fluoride (PubChem CID 168677760) has the molecular formula C9H10FN3O3S and a molecular weight of 259.26 g/mol. Its IUPAC name is (5-oxo-1-pyridazin-4-ylpyrrolidin-3-yl)methanesulfonyl fluoride.
| Compound Name | (5-oxo-1-pyridazin-4-ylpyrrolidin-3-yl)methanesulfonyl fluoride |
|---|---|
| PubChem CID | 168677760 |
| Molecular Formula | C9H10FN3O3S |
| Molecular Weight | 259.26 g/mol |
| Exact Mass | 259.04 |
| IUPAC Name | (5-oxo-1-pyridazin-4-ylpyrrolidin-3-yl)methanesulfonyl fluoride |
| SMILES | O=C1CC(CS(=O)(=O)F)CN1c1ccnnc1 |
| InChI | InChI=1S/C9H10FN3O3S/c10-17(15,16)6-7-3-9(14)13(5-7)8-1-2-11-12-4-8/h1-2,4,7H,3,5-6H2 |
| InChIKey | GBLPKRBKSJKIJR-UHFFFAOYSA-N |
| XLogP | 0.13 |
| TPSA | 80.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.26 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |