C12H12FN3O3S — CID 168677060
[1-(3H-benzimidazol-5-yl)-5-oxopyrrolidin-3-yl]methanesulfonyl fluoride (PubChem CID 168677060) has the molecular formula C12H12FN3O3S and a molecular weight of 297.31 g/mol. Its IUPAC name is [1-(3H-benzimidazol-5-yl)-5-oxopyrrolidin-3-yl]methanesulfonyl fluoride.
| Compound Name | [1-(3H-benzimidazol-5-yl)-5-oxopyrrolidin-3-yl]methanesulfonyl fluoride |
|---|---|
| PubChem CID | 168677060 |
| Molecular Formula | C12H12FN3O3S |
| Molecular Weight | 297.31 g/mol |
| Exact Mass | 297.06 |
| IUPAC Name | [1-(3H-benzimidazol-5-yl)-5-oxopyrrolidin-3-yl]methanesulfonyl fluoride |
| SMILES | O=C1CC(CS(=O)(=O)F)CN1c1ccc2nc[nH]c2c1 |
| InChI | InChI=1S/C12H12FN3O3S/c13-20(18,19)6-8-3-12(17)16(5-8)9-1-2-10-11(4-9)15-7-14-10/h1-2,4,7-8H,3,5-6H2,(H,14,15) |
| InChIKey | RESUGFLEEKRNNW-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 83.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.31 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |